Difference between revisions of "4-MALEYL-ACETOACETATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHENYLACETATE == * common-name: ** phenylacetate * molecular-weight: ** 135.142 * inchi-key: ** wljvxdmoqogphl-uhfffaoysa-m * smiles: **...")
(Created page with "Category:metabolite == Metabolite Plastocyanin-Reduced == * common-name: ** a reduced plastocyanin == Reaction(s) known to consume the compound == == Reaction(s) known to...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHENYLACETATE ==
+
== Metabolite Plastocyanin-Reduced ==
 
* common-name:
 
* common-name:
** phenylacetate
+
** a reduced plastocyanin
* molecular-weight:
 
** 135.142
 
* inchi-key:
 
** wljvxdmoqogphl-uhfffaoysa-m
 
* smiles:
 
** c1(=cc=c(c=c1)cc([o-])=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHENDEHYD-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PHENDEHYD-RXN]]
+
* [[PLASTOQUINOL--PLASTOCYANIN-REDUCTASE-RXN]]
 +
* [[RXN-12647]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phenylacetate}}
+
{{#set: common-name=a reduced plastocyanin}}
{{#set: molecular-weight=135.142}}
 
{{#set: inchi-key=inchikey=wljvxdmoqogphl-uhfffaoysa-m}}
 

Revision as of 19:02, 17 March 2021

Metabolite Plastocyanin-Reduced

  • common-name:
    • a reduced plastocyanin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality