Difference between revisions of "GLY-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N2-ACETYL-ALPHA-AMIN == * common-name: ** n2-acetyl-α-aminoadipate * molecular-weight: ** 201.179 * inchi-key: ** fttgaazkbnzdcz-lu...")
(Created page with "Category:metabolite == Metabolite URACIL == * common-name: ** uracil * molecular-weight: ** 112.088 * inchi-key: ** isakrjdgnuqoic-uhfffaoysa-n * smiles: ** c1(=cc(nc(=o)n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N2-ACETYL-ALPHA-AMIN ==
+
== Metabolite URACIL ==
 
* common-name:
 
* common-name:
** n2-acetyl-α-aminoadipate
+
** uracil
 
* molecular-weight:
 
* molecular-weight:
** 201.179
+
** 112.088
 
* inchi-key:
 
* inchi-key:
** fttgaazkbnzdcz-lurjtmiesa-l
+
** isakrjdgnuqoic-uhfffaoysa-n
 
* smiles:
 
* smiles:
** cc(=o)nc(cccc(=o)[o-])c(=o)[o-]
+
** c1(=cc(nc(=o)n1)=o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-5181]]
+
* [[RXN0-5398]]
 +
* [[URACIL-PRIBOSYLTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5181]]
+
* [[RXN0-5398]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n2-acetyl-α-aminoadipate}}
+
{{#set: common-name=uracil}}
{{#set: molecular-weight=201.179}}
+
{{#set: molecular-weight=112.088}}
{{#set: inchi-key=inchikey=fttgaazkbnzdcz-lurjtmiesa-l}}
+
{{#set: inchi-key=inchikey=isakrjdgnuqoic-uhfffaoysa-n}}

Revision as of 19:03, 17 March 2021

Metabolite URACIL

  • common-name:
    • uracil
  • molecular-weight:
    • 112.088
  • inchi-key:
    • isakrjdgnuqoic-uhfffaoysa-n
  • smiles:
    • c1(=cc(nc(=o)n1)=o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality