Difference between revisions of "Sulfhydryls"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXINE-5P == * common-name: ** pyridoxine 5'-phosphate * molecular-weight: ** 247.144 * inchi-key: ** whomfkwhiqzthy-uhfffaoysa-l * s...")
(Created page with "Category:metabolite == Metabolite ERYTHROSE-4P == * common-name: ** d-erythrose 4-phosphate * molecular-weight: ** 198.069 * inchi-key: ** nghmdnpxvrffgs-iuyqgcfvsa-l * sm...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PYRIDOXINE-5P ==
+
== Metabolite ERYTHROSE-4P ==
 
* common-name:
 
* common-name:
** pyridoxine 5'-phosphate
+
** d-erythrose 4-phosphate
 
* molecular-weight:
 
* molecular-weight:
** 247.144
+
** 198.069
 
* inchi-key:
 
* inchi-key:
** whomfkwhiqzthy-uhfffaoysa-l
+
** nghmdnpxvrffgs-iuyqgcfvsa-l
 
* smiles:
 
* smiles:
** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co)
+
** [ch](c(c(cop([o-])([o-])=o)o)o)=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PNPOXI-RXN]]
+
* [[2TRANSKETO-RXN]]
 +
* [[DAHPSYN-RXN]]
 +
* [[SEDOBISALDOL-RXN]]
 +
* [[TRANSALDOL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PDXJ-RXN]]
+
* [[2TRANSKETO-RXN]]
* [[PNKIN-RXN]]
+
* [[DAHPSYN-RXN]]
 +
* [[SEDOBISALDOL-RXN]]
 +
* [[TRANSALDOL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pyridoxine 5'-phosphate}}
+
{{#set: common-name=d-erythrose 4-phosphate}}
{{#set: molecular-weight=247.144}}
+
{{#set: molecular-weight=198.069}}
{{#set: inchi-key=inchikey=whomfkwhiqzthy-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=nghmdnpxvrffgs-iuyqgcfvsa-l}}

Revision as of 19:03, 17 March 2021

Metabolite ERYTHROSE-4P

  • common-name:
    • d-erythrose 4-phosphate
  • molecular-weight:
    • 198.069
  • inchi-key:
    • nghmdnpxvrffgs-iuyqgcfvsa-l
  • smiles:
    • [ch](c(c(cop([o-])([o-])=o)o)o)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality