Difference between revisions of "XYLULOSE-5-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-KETOGLUTARATE == * common-name: ** 2-oxoglutarate * molecular-weight: ** 144.084 * inchi-key: ** kpgxrsrhynqifn-uhfffaoysa-l * smiles:...")
(Created page with "Category:metabolite == Metabolite Petrosel-2-enoyl-ACPs == * common-name: ** a (2e,6z)-octadecadienoyl-[acp] == Reaction(s) known to consume the compound == == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-KETOGLUTARATE ==
+
== Metabolite Petrosel-2-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** 2-oxoglutarate
+
** a (2e,6z)-octadecadienoyl-[acp]
* molecular-weight:
 
** 144.084
 
* inchi-key:
 
** kpgxrsrhynqifn-uhfffaoysa-l
 
* smiles:
 
** c(cc([o-])=o)c(=o)c([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[1.14.11.2-RXN]]
 
* [[2.5.1.64-RXN]]
 
* [[2.6.1.22-RXN]]
 
* [[2.6.1.57-RXN]]
 
* [[2.6.1.7-RXN]]
 
* [[2OXOGLUTDECARB-RXN]]
 
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 
* [[ACETYLORNTRANSAM-RXN]]
 
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 
* [[ASPAMINOTRANS-RXN]]
 
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
 
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 
* [[DIAMTRANSAM-RXN]]
 
* [[GLUTAMATE-DEHYDROGENASE-NADP+-RXN]]
 
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
 
* [[GLUTAMATESYN-RXN]]
 
* [[GLUTDEHYD-RXN]]
 
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 
* [[HISTAMINOTRANS-RXN]]
 
* [[ISOCITDEH-RXN]]
 
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
 
* [[PHEAMINOTRANS-RXN]]
 
* [[PREPHENATE-TRANSAMINE-RXN]]
 
* [[PSERTRANSAM-RXN]]
 
* [[PSERTRANSAMPYR-RXN]]
 
* [[PUTTRANSAM-RXN]]
 
* [[RXN-10721]]
 
* [[RXN-10814]]
 
* [[RXN-113]]
 
* [[RXN-115]]
 
* [[RXN-11737]]
 
* [[RXN-13186]]
 
* [[RXN-13697]]
 
* [[RXN-13698]]
 
* [[RXN-14147]]
 
* [[RXN-14981]]
 
* [[RXN-15007]]
 
* [[RXN-171]]
 
* [[RXN-17679]]
 
* [[RXN-527]]
 
* [[RXN-602]]
 
* [[RXN-6550]]
 
* [[RXN-7648]]
 
* [[RXN-7737]]
 
* [[RXN-7775]]
 
* [[RXN-7922]]
 
* [[RXN-8450]]
 
* [[RXN-8642]]
 
* [[RXN-8660]]
 
* [[RXN-8661]]
 
* [[RXN1F-162]]
 
* [[RXN1F-163]]
 
* [[RXN1F-165]]
 
* [[RXN1F-167]]
 
* [[RXN1F-168]]
 
* [[RXN1F-93]]
 
* [[RXN490-3641]]
 
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-9553]]
* [[2.6.1.22-RXN]]
 
* [[2.6.1.57-RXN]]
 
* [[2.6.1.7-RXN]]
 
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 
* [[ACETYLORNTRANSAM-RXN]]
 
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 
* [[ASPAMINOTRANS-RXN]]
 
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
 
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 
* [[DIAMTRANSAM-RXN]]
 
* [[GLUTAMATE-DEHYDROGENASE-NADP+-RXN]]
 
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 
* [[GLUTDEHYD-RXN]]
 
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 
* [[HISTAMINOTRANS-RXN]]
 
* [[ISOCITDEH-RXN]]
 
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 
* [[PHEAMINOTRANS-RXN]]
 
* [[PREPHENATE-TRANSAMINE-RXN]]
 
* [[PSERTRANSAM-RXN]]
 
* [[PSERTRANSAMPYR-RXN]]
 
* [[RXN-10721]]
 
* [[RXN-10814]]
 
* [[RXN-11737]]
 
* [[RXN-12878]]
 
* [[RXN-13697]]
 
* [[RXN-13698]]
 
* [[RXN-14147]]
 
* [[RXN-15007]]
 
* [[RXN-17679]]
 
* [[RXN-7737]]
 
* [[RXN-8642]]
 
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-oxoglutarate}}
+
{{#set: common-name=a (2e,6z)-octadecadienoyl-[acp]}}
{{#set: molecular-weight=144.084}}
 
{{#set: inchi-key=inchikey=kpgxrsrhynqifn-uhfffaoysa-l}}
 

Revision as of 19:03, 17 March 2021

Metabolite Petrosel-2-enoyl-ACPs

  • common-name:
    • a (2e,6z)-octadecadienoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (2e,6z)-octadecadienoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.