Difference between revisions of "2-KETOGLUTARATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19010 == * common-name: ** 1,2-epoxy-2-methylpropane * molecular-weight: ** 72.107 * inchi-key: ** gelkghvafrcjna-uhfffaoysa-n * smil...") |
(Created page with "Category:metabolite == Metabolite DOPAQUINONE == * common-name: ** dopaquinone * molecular-weight: ** 195.174 * inchi-key: ** ahmiduvksgchau-lurjtmiesa-n * smiles: ** c([o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DOPAQUINONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** dopaquinone |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 195.174 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ahmiduvksgchau-lurjtmiesa-n |
* smiles: | * smiles: | ||
| − | ** cc1(c) | + | ** c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11369]] |
| + | * [[RXN-8483]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[MONOPHENOL-MONOOXYGENASE-RXN]] | ||
| + | * [[RXN-13061]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dopaquinone}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=195.174}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ahmiduvksgchau-lurjtmiesa-n}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite DOPAQUINONE
- common-name:
- dopaquinone
- molecular-weight:
- 195.174
- inchi-key:
- ahmiduvksgchau-lurjtmiesa-n
- smiles:
- c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1)
