Difference between revisions of "2-DEOXYRIBOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Butanoyl-ACPs == * common-name: ** a butanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9516 * RXN-9648 == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-8121 == * common-name: ** icosatetraenoate * molecular-weight: ** 303.464 * inchi-key: ** hqpcsdadvlfhho-ltkcoykysa-m * smiles: ** cc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-8121 == |
* common-name: | * common-name: | ||
− | ** | + | ** icosatetraenoate |
+ | * molecular-weight: | ||
+ | ** 303.464 | ||
+ | * inchi-key: | ||
+ | ** hqpcsdadvlfhho-ltkcoykysa-m | ||
+ | * smiles: | ||
+ | ** ccc=ccc=ccc=ccc=cccccccc([o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-8349_PLANTCYC]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-8349_PLANTCYC]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=icosatetraenoate}} |
+ | {{#set: molecular-weight=303.464}} | ||
+ | {{#set: inchi-key=inchikey=hqpcsdadvlfhho-ltkcoykysa-m}} |
Revision as of 19:04, 17 March 2021
Contents
Metabolite CPD-8121
- common-name:
- icosatetraenoate
- molecular-weight:
- 303.464
- inchi-key:
- hqpcsdadvlfhho-ltkcoykysa-m
- smiles:
- ccc=ccc=ccc=ccc=cccccccc([o-])=o