Difference between revisions of "All-trans-Retinyl-Esters"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite apo-ACP == * common_name: ** an apo-[acyl-carrier protein] == Reaction(s) known to consume the compound == == Reaction(s) known to produc...") |
(Created page with "Category:metabolite == Metabolite ENOL-PHENYLPYRUVATE == * common-name: ** enol-phenylpyruvate * molecular-weight: ** 163.152 * inchi-key: ** dedgugjnlnljsr-vurmdhgxsa-m *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ENOL-PHENYLPYRUVATE == |
| − | * | + | * common-name: |
| − | ** | + | ** enol-phenylpyruvate |
| + | * molecular-weight: | ||
| + | ** 163.152 | ||
| + | * inchi-key: | ||
| + | ** dedgugjnlnljsr-vurmdhgxsa-m | ||
| + | * smiles: | ||
| + | ** c([o-])(=o)c(o)=cc1(c=cc=cc=1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PHENYLPYRUVATE-TAUTOMERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=enol-phenylpyruvate}} |
| + | {{#set: molecular-weight=163.152}} | ||
| + | {{#set: inchi-key=inchikey=dedgugjnlnljsr-vurmdhgxsa-m}} | ||
Revision as of 19:04, 17 March 2021
Contents
Metabolite ENOL-PHENYLPYRUVATE
- common-name:
- enol-phenylpyruvate
- molecular-weight:
- 163.152
- inchi-key:
- dedgugjnlnljsr-vurmdhgxsa-m
- smiles:
- c([o-])(=o)c(o)=cc1(c=cc=cc=1)
