Difference between revisions of "CPD-12377"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-786 == * common-name: ** (4z)-2-oxohept-4-enedioate * molecular-weight: ** 170.121 * inchi-key: ** icgkeqxhpzuysf-uphrsurjsa-l * smil...")
(Created page with "Category:metabolite == Metabolite CPD-12377 == * common-name: ** hydroxyl radical * molecular-weight: ** 17.007 * inchi-key: ** tujkjamukrirhc-uhfffaoysa-n * smiles: ** o...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-786 ==
+
== Metabolite CPD-12377 ==
 
* common-name:
 
* common-name:
** (4z)-2-oxohept-4-enedioate
+
** hydroxyl radical
 
* molecular-weight:
 
* molecular-weight:
** 170.121
+
** 17.007
 
* inchi-key:
 
* inchi-key:
** icgkeqxhpzuysf-uphrsurjsa-l
+
** tujkjamukrirhc-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(cc=ccc(c([o-])=o)=o)([o-])=o
+
** o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11409]]
 +
* [[RXN-11410]]
 +
* [[RXN-12539]]
 +
* [[RXN-14290]]
 +
* [[RXN-15139]]
 +
* [[RXN0-7080]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1K-87]]
+
* [[RXN-12540]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4z)-2-oxohept-4-enedioate}}
+
{{#set: common-name=hydroxyl radical}}
{{#set: molecular-weight=170.121}}
+
{{#set: molecular-weight=17.007}}
{{#set: inchi-key=inchikey=icgkeqxhpzuysf-uphrsurjsa-l}}
+
{{#set: inchi-key=inchikey=tujkjamukrirhc-uhfffaoysa-n}}

Latest revision as of 19:32, 17 March 2021

Metabolite CPD-12377

  • common-name:
    • hydroxyl radical
  • molecular-weight:
    • 17.007
  • inchi-key:
    • tujkjamukrirhc-uhfffaoysa-n
  • smiles:
    • o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality