Difference between revisions of "L-1-PHOSPHATIDYL-ETHANOLAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MPBQ == * common-name: ** 2-methyl-6-phytyl-1,4-benzoquinol * molecular-weight: ** 402.659 * inchi-key: ** gtwcnyrfozkwtl-uofxaseasa-n *...")
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE == * common-name: ** an l-1-phosphatidylethanolamine == Reaction(s) known to consume the compound == * RX...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MPBQ ==
+
== Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE ==
 
* common-name:
 
* common-name:
** 2-methyl-6-phytyl-1,4-benzoquinol
+
** an l-1-phosphatidylethanolamine
* molecular-weight:
 
** 402.659
 
* inchi-key:
 
** gtwcnyrfozkwtl-uofxaseasa-n
 
* smiles:
 
** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2542]]
+
* [[RXN0-6725]]
* [[RXN-2561]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2541]]
+
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methyl-6-phytyl-1,4-benzoquinol}}
+
{{#set: common-name=an l-1-phosphatidylethanolamine}}
{{#set: molecular-weight=402.659}}
 
{{#set: inchi-key=inchikey=gtwcnyrfozkwtl-uofxaseasa-n}}
 

Latest revision as of 19:32, 17 March 2021

Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE

  • common-name:
    • an l-1-phosphatidylethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality