Difference between revisions of "Cis-delta19-3-oxo-C38-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17383 == * common-name: ** (2e,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * molecular-weight: ** 1102.034 * inchi-key: ** mmzjvinjfsr...")
(Created page with "Category:metabolite == Metabolite cis-delta19-3-oxo-C38-ACPs == * common-name: ** a cis-delta19-3-oxo-c38:1-[acp] == Reaction(s) known to consume the compound == * RXN1G...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-17383 ==
+
== Metabolite cis-delta19-3-oxo-C38-ACPs ==
 
* common-name:
 
* common-name:
−
** (2e,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** a cis-delta19-3-oxo-c38:1-[acp]
−
* molecular-weight:
 
−
** 1102.034
 
−
* inchi-key:
 
−
** mmzjvinjfsrjok-cynjbpnesa-j
 
−
* smiles:
 
−
** ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16131]]
+
* [[RXN1G-1053]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16130]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(2e,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=a cis-delta19-3-oxo-c38:1-[acp]}}
−
{{#set: molecular-weight=1102.034}}
 
−
{{#set: inchi-key=inchikey=mmzjvinjfsrjok-cynjbpnesa-j}}
 

Latest revision as of 19:32, 17 March 2021

Metabolite cis-delta19-3-oxo-C38-ACPs

  • common-name:
    • a cis-delta19-3-oxo-c38:1-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis-delta19-3-oxo-c38:1-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Cis-delta19-3-oxo-C38-ACPs&oldid=48332"