Difference between revisions of "BILIVERDINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12014 == * common-name: ** 6-hydroxymelatonin * molecular-weight: ** 248.281 * inchi-key: ** omymrcxojjzyke-uhfffaoysa-n * smiles: **...") |
(Created page with "Category:metabolite == Metabolite BILIVERDINE == * common-name: ** (z,z)-biliverdin-ix α * molecular-weight: ** 580.639 * inchi-key: ** qbuvfdktzjnupp-bbroenkcsa-l *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BILIVERDINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (z,z)-biliverdin-ix α |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 580.639 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qbuvfdktzjnupp-bbroenkcsa-l |
* smiles: | * smiles: | ||
| − | ** | + | ** c=cc1(=c(c)c(nc1=cc4(=c(c)c(ccc(=o)[o-])=c(c=c2(c(ccc(=o)[o-])=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[1.3.7.4-RXN]] |
| + | * [[BILIVERDIN-REDUCTASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(z,z)-biliverdin-ix α}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=580.639}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qbuvfdktzjnupp-bbroenkcsa-l}} |
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite BILIVERDINE
- common-name:
- (z,z)-biliverdin-ix α
- molecular-weight:
- 580.639
- inchi-key:
- qbuvfdktzjnupp-bbroenkcsa-l
- smiles:
- c=cc1(=c(c)c(nc1=cc4(=c(c)c(ccc(=o)[o-])=c(c=c2(c(ccc(=o)[o-])=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
