Difference between revisions of "CPD-7247"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-Prime-Ribonucleoside-Monophosphates == * common_name: ** a ribonucleoside 3'-phosphate == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite CPD-7247 == * common-name: ** all-trans-13,14-dihydroretinol * molecular-weight: ** 288.472 * inchi-key: ** ovboqvaiymsudt-hrygcdposa-n *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7247 == |
− | * | + | * common-name: |
− | ** | + | ** all-trans-13,14-dihydroretinol |
+ | * molecular-weight: | ||
+ | ** 288.472 | ||
+ | * inchi-key: | ||
+ | ** ovboqvaiymsudt-hrygcdposa-n | ||
+ | * smiles: | ||
+ | ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[3. | + | * [[1.3.99.23-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: | + | {{#set: common-name=all-trans-13,14-dihydroretinol}} |
+ | {{#set: molecular-weight=288.472}} | ||
+ | {{#set: inchi-key=inchikey=ovboqvaiymsudt-hrygcdposa-n}} |
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite CPD-7247
- common-name:
- all-trans-13,14-dihydroretinol
- molecular-weight:
- 288.472
- inchi-key:
- ovboqvaiymsudt-hrygcdposa-n
- smiles:
- cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1)