Difference between revisions of "CPD-7247"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-Prime-Ribonucleoside-Monophosphates == * common_name: ** a ribonucleoside 3'-phosphate == Reaction(s) known to consume the compound ==...")
(Created page with "Category:metabolite == Metabolite CPD-7247 == * common-name: ** all-trans-13,14-dihydroretinol * molecular-weight: ** 288.472 * inchi-key: ** ovboqvaiymsudt-hrygcdposa-n *...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-Prime-Ribonucleoside-Monophosphates ==
+
== Metabolite CPD-7247 ==
* common_name:
+
* common-name:
** a ribonucleoside 3'-phosphate
+
** all-trans-13,14-dihydroretinol
 +
* molecular-weight:
 +
** 288.472
 +
* inchi-key:
 +
** ovboqvaiymsudt-hrygcdposa-n
 +
* smiles:
 +
** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.27.1-RXN]]
+
* [[1.3.99.23-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=a ribonucleoside 3'-phosphate}}
+
{{#set: common-name=all-trans-13,14-dihydroretinol}}
 +
{{#set: molecular-weight=288.472}}
 +
{{#set: inchi-key=inchikey=ovboqvaiymsudt-hrygcdposa-n}}

Latest revision as of 19:33, 17 March 2021

Metabolite CPD-7247

  • common-name:
    • all-trans-13,14-dihydroretinol
  • molecular-weight:
    • 288.472
  • inchi-key:
    • ovboqvaiymsudt-hrygcdposa-n
  • smiles:
    • cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality