Difference between revisions of "Decanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHO-ENOL-PYRUVATE == * common-name: ** phosphoenolpyruvate * molecular-weight: ** 165.019 * inchi-key: ** dtbnbxwjwcwcik-uhfffaoysa-k...")
(Created page with "Category:metabolite == Metabolite Decanoyl-ACPs == * common-name: ** a decanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9531 * RXN-9652 == Reac...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHO-ENOL-PYRUVATE ==
+
== Metabolite Decanoyl-ACPs ==
 
* common-name:
 
* common-name:
** phosphoenolpyruvate
+
** a decanoyl-[acp]
* molecular-weight:
 
** 165.019
 
* inchi-key:
 
** dtbnbxwjwcwcik-uhfffaoysa-k
 
* smiles:
 
** c=c(op([o-])([o-])=o)c([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.19-RXN]]
+
* [[RXN-9531]]
* [[2PGADEHYDRAT-RXN]]
+
* [[RXN-9652]]
* [[DAHPSYN-RXN]]
 
* [[PEPCARBOX-RXN]]
 
* [[PEPDEPHOS-RXN]]
 
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 
* [[RXN-14117]]
 
* [[RXN-14192]]
 
* [[RXN-14207]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.19-RXN]]
+
* [[RXN-9530]]
* [[2PGADEHYDRAT-RXN]]
+
* [[RXN-9660]]
* [[DAHPSYN-RXN]]
 
* [[PEPCARBOXYKIN-RXN]]
 
* [[PEPSYNTH-RXN]]
 
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phosphoenolpyruvate}}
+
{{#set: common-name=a decanoyl-[acp]}}
{{#set: molecular-weight=165.019}}
 
{{#set: inchi-key=inchikey=dtbnbxwjwcwcik-uhfffaoysa-k}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite Decanoyl-ACPs

  • common-name:
    • a decanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a decanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.