Difference between revisions of "L-PANTOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11412 == * common-name: ** triiodothyroacetate ester glucuronide * molecular-weight: ** 797.054 * inchi-key: ** fpejnmnxcsitjo-kfyubc...")
(Created page with "Category:metabolite == Metabolite L-PANTOATE == * common-name: ** (r)-pantoate * molecular-weight: ** 147.15 * inchi-key: ** otoiipjyvqjatp-bypyzucnsa-m * smiles: ** cc(c)...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11412 ==
+
== Metabolite L-PANTOATE ==
 
* common-name:
 
* common-name:
** triiodothyroacetate ester glucuronide
+
** (r)-pantoate
 
* molecular-weight:
 
* molecular-weight:
** 797.054
+
** 147.15
 
* inchi-key:
 
* inchi-key:
** fpejnmnxcsitjo-kfyubchvsa-m
+
** otoiipjyvqjatp-bypyzucnsa-m
 
* smiles:
 
* smiles:
** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
+
** cc(c)(co)c(c([o-])=o)o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10618]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=triiodothyroacetate ester glucuronide}}
+
{{#set: common-name=(r)-pantoate}}
{{#set: molecular-weight=797.054}}
+
{{#set: molecular-weight=147.15}}
{{#set: inchi-key=inchikey=fpejnmnxcsitjo-kfyubchvsa-m}}
+
{{#set: inchi-key=inchikey=otoiipjyvqjatp-bypyzucnsa-m}}

Latest revision as of 19:33, 17 March 2021

Metabolite L-PANTOATE

  • common-name:
    • (r)-pantoate
  • molecular-weight:
    • 147.15
  • inchi-key:
    • otoiipjyvqjatp-bypyzucnsa-m
  • smiles:
    • cc(c)(co)c(c([o-])=o)o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality