Difference between revisions of "P-NITROPHENOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite cis-19-CP-37-Mex-38-Me-C59-ACPs == * common-name: ** a cis-methoxy-c59-meroacyl-[acp] == Reaction(s) known to consume the compound == * [...") |
(Created page with "Category:metabolite == Metabolite P-NITROPHENOL == * common-name: ** 4-nitrophenol * molecular-weight: ** 138.102 * inchi-key: ** btjiuguipkrlhp-uhfffaoysa-m * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite P-NITROPHENOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-nitrophenol |
| + | * molecular-weight: | ||
| + | ** 138.102 | ||
| + | * inchi-key: | ||
| + | ** btjiuguipkrlhp-uhfffaoysa-m | ||
| + | * smiles: | ||
| + | ** c1(c=c([o-])c=cc=1[n+](=o)[o-]) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[4-NITROPHENYLPHOSPHATASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-nitrophenol}} |
| + | {{#set: molecular-weight=138.102}} | ||
| + | {{#set: inchi-key=inchikey=btjiuguipkrlhp-uhfffaoysa-m}} | ||
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite P-NITROPHENOL
- common-name:
- 4-nitrophenol
- molecular-weight:
- 138.102
- inchi-key:
- btjiuguipkrlhp-uhfffaoysa-m
- smiles:
- c1(c=c([o-])c=cc=1[n+](=o)[o-])
