Difference between revisions of "THREO-DS-ISO-CITRATE"

Latest revision as of 19:33, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-506 ==
+== Metabolite THREO-DS-ISO-CITRATE ==
 * common-name:
-** d-myo-inositol (1,3,4,5)-tetrakisphosphate
+** d-threo-isocitrate
 * molecular-weight:
-** 492.013
+** 189.101
 * inchi-key:
-** cipfcgzlfxvxbg-cnwjwelysa-f
+** odblhexudapzau-zafykaaxsa-k
 * smiles:
-** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
+** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-]
 == Reaction(s) known to consume the compound ==
-* [[3.1.3.62-RXN]]
+* [[ACONITATEHYDR-RXN]]
-* [[RXN-8730]]
+* [[ISOCIT-CLEAV-RXN]]
+* [[ISOCITDEH-RXN]]
+* [[RXN-14047]]
+* [[RXN-9951]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[2.7.1.127-RXN]]
+* [[ACONITATEHYDR-RXN]]
-* [[2.7.1.139-RXN]]
+* [[ISOCIT-CLEAV-RXN]]
+* [[ISOCITDEH-RXN]]
+* [[RXN-14047]]
+* [[RXN-9951]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}}
+{{#set: common-name=d-threo-isocitrate}}
-{{#set: molecular-weight=492.013}}
+{{#set: molecular-weight=189.101}}
-{{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}}
+{{#set: inchi-key=inchikey=odblhexudapzau-zafykaaxsa-k}}