Difference between revisions of "CIS-ACONITATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Holo-LYS2-peptidyl-carrier-protein == * common-name: ** a holo-[lys2 l-2-aminoadipyl-carrier-protein] == Reaction(s) known to consume the...")
(Created page with "Category:metabolite == Metabolite CIS-ACONITATE == * common-name: ** cis-aconitate * molecular-weight: ** 171.086 * inchi-key: ** gtzcvfvgugfeme-iwqzzhsrsa-k * smiles: **...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Holo-LYS2-peptidyl-carrier-protein ==
+
== Metabolite CIS-ACONITATE ==
 
* common-name:
 
* common-name:
** a holo-[lys2 l-2-aminoadipyl-carrier-protein]
+
** cis-aconitate
 +
* molecular-weight:
 +
** 171.086
 +
* inchi-key:
 +
** gtzcvfvgugfeme-iwqzzhsrsa-k
 +
* smiles:
 +
** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16759]]
+
* [[ACONITATEDEHYDR-RXN]]
 +
* [[ACONITATEHYDR-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16759]]
+
* [[ACONITATEDEHYDR-RXN]]
 +
* [[ACONITATEHYDR-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a holo-[lys2 l-2-aminoadipyl-carrier-protein]}}
+
{{#set: common-name=cis-aconitate}}
 +
{{#set: molecular-weight=171.086}}
 +
{{#set: inchi-key=inchikey=gtzcvfvgugfeme-iwqzzhsrsa-k}}

Latest revision as of 19:33, 17 March 2021

Metabolite CIS-ACONITATE

  • common-name:
    • cis-aconitate
  • molecular-weight:
    • 171.086
  • inchi-key:
    • gtzcvfvgugfeme-iwqzzhsrsa-k
  • smiles:
    • c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality