Difference between revisions of "K+"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI == * common-name: ** leukotriene b4 * molecular-weight: ** 335.462 * inchi-key: ** vnyssyrcgwbhlg-amolwhm...")
(Created page with "Category:metabolite == Metabolite K+ == * common-name: ** k+ * molecular-weight: ** 39.098 * inchi-key: ** npypahlbtdxsss-uhfffaoysa-n * smiles: ** [k+] == Reaction(s) kno...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI ==
+
== Metabolite K+ ==
 
* common-name:
 
* common-name:
** leukotriene b4
+
** k+
 
* molecular-weight:
 
* molecular-weight:
** 335.462
+
** 39.098
 
* inchi-key:
 
* inchi-key:
** vnyssyrcgwbhlg-amolwhmgsa-m
+
** npypahlbtdxsss-uhfffaoysa-n
 
* smiles:
 
* smiles:
** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-]
+
** [k+]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.6.3.9-RXN]]
 +
* [[ExchangeSeed-K+]]
 +
* [[TransportSeed-K+]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LEUKOTRIENE-A4-HYDROLASE-RXN]]
+
* [[3.6.3.9-RXN]]
 +
* [[ExchangeSeed-K+]]
 +
* [[TransportSeed-K+]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=leukotriene b4}}
+
{{#set: common-name=k+}}
{{#set: molecular-weight=335.462}}
+
{{#set: molecular-weight=39.098}}
{{#set: inchi-key=inchikey=vnyssyrcgwbhlg-amolwhmgsa-m}}
+
{{#set: inchi-key=inchikey=npypahlbtdxsss-uhfffaoysa-n}}

Latest revision as of 19:33, 17 March 2021

Metabolite K+

  • common-name:
    • k+
  • molecular-weight:
    • 39.098
  • inchi-key:
    • npypahlbtdxsss-uhfffaoysa-n
  • smiles:
    • [k+]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality