Difference between revisions of "Menaquinols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-PROTOCATECHUOYLPHLOROGLUCINOLCARBOXYLA == * common-name: ** 2-protocatechuoylphloroglucinolcarboxylate * molecular-weight: ** 305.22 *...")
(Created page with "Category:metabolite == Metabolite Menaquinols == * common-name: ** a menaquinol == Reaction(s) known to consume the compound == * RXN-14107 == Reaction(s) known to pro...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-PROTOCATECHUOYLPHLOROGLUCINOLCARBOXYLA ==
+
== Metabolite Menaquinols ==
 
* common-name:
 
* common-name:
** 2-protocatechuoylphloroglucinolcarboxylate
+
** a menaquinol
* molecular-weight:
 
** 305.22
 
* inchi-key:
 
** grxielrcpyieqi-uhfffaoysa-m
 
* smiles:
 
** c(c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(=c(c=2)o)o))=o))([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14107]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[QUERCETIN-23-DIOXYGENASE-RXN]]
+
* [[RXN0-5254]]
 +
* [[RXN0-6554]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-protocatechuoylphloroglucinolcarboxylate}}
+
{{#set: common-name=a menaquinol}}
{{#set: molecular-weight=305.22}}
 
{{#set: inchi-key=inchikey=grxielrcpyieqi-uhfffaoysa-m}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite Menaquinols

  • common-name:
    • a menaquinol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality