Difference between revisions of "L-ALPHA-ALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14407 == * common-name: ** dihomo γ-linolenoyl-coa * molecular-weight: ** 1051.975 * inchi-key: ** fjwjalrunnzibb-ddquopdjsa-j...")
(Created page with "Category:metabolite == Metabolite L-ALPHA-ALANINE == * common-name: ** l-alanine * molecular-weight: ** 89.094 * inchi-key: ** qnaybmklocpygj-reohclbhsa-n * smiles: ** cc(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-14407 ==
+
== Metabolite L-ALPHA-ALANINE ==
 
* common-name:
 
* common-name:
−
** dihomo γ-linolenoyl-coa
+
** l-alanine
 
* molecular-weight:
 
* molecular-weight:
−
** 1051.975
+
** 89.094
 
* inchi-key:
 
* inchi-key:
−
** fjwjalrunnzibb-ddquopdjsa-j
+
** qnaybmklocpygj-reohclbhsa-n
 
* smiles:
 
* smiles:
−
** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc([n+])c([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-13435]]
+
* [[2.6.1.58-RXN]]
−
* [[RXN-16044]]
+
* [[7KAPSYN-RXN]]
 +
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 +
* [[ALANINE--TRNA-LIGASE-RXN]]
 +
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[GLUTAMINE--PYRUVATE-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-13698]]
 +
* [[RXN-14467]]
 +
* [[RXN-7571]]
 +
* [[RXN3O-4157]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-17105]]
+
* [[2.6.1.58-RXN]]
 +
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 +
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[GLUTAMINE--PYRUVATE-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-12588]]
 +
* [[RXN-13698]]
 +
* [[RXN-14385]]
 +
* [[RXN-14467]]
 +
* [[RXN-15881]]
 +
* [[RXN-7571]]
 +
* [[RXN-9787]]
 +
* [[RXN0-308]]
 +
* [[RXN3O-4157]]
 +
* [[SELENOCYSTEINE-LYASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=dihomo γ-linolenoyl-coa}}
+
{{#set: common-name=l-alanine}}
−
{{#set: molecular-weight=1051.975}}
+
{{#set: molecular-weight=89.094}}
−
{{#set: inchi-key=inchikey=fjwjalrunnzibb-ddquopdjsa-j}}
+
{{#set: inchi-key=inchikey=qnaybmklocpygj-reohclbhsa-n}}

Latest revision as of 19:34, 17 March 2021

Metabolite L-ALPHA-ALANINE

  • common-name:
    • l-alanine
  • molecular-weight:
    • 89.094
  • inchi-key:
    • qnaybmklocpygj-reohclbhsa-n
  • smiles:
    • cc([n+])c([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=L-ALPHA-ALANINE&oldid=48972"