Difference between revisions of "CPD-356"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15301 == * common-name: ** caldariellaquinol * molecular-weight: ** 633.085 * inchi-key: ** uvcqokdzgiahdg-uhfffaoysa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite CPD-356 == * common-name: ** d-arabinono-1,4-lactone * molecular-weight: ** 148.115 * inchi-key: ** cuokhacjlgprhd-jjyyjpossa-n * smiles:...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15301 ==
+
== Metabolite CPD-356 ==
 
* common-name:
 
* common-name:
** caldariellaquinol
+
** d-arabinono-1,4-lactone
 
* molecular-weight:
 
* molecular-weight:
** 633.085
+
** 148.115
 
* inchi-key:
 
* inchi-key:
** uvcqokdzgiahdg-uhfffaoysa-n
+
** cuokhacjlgprhd-jjyyjpossa-n
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))
+
** c(o)c1(oc(=o)c(o)c(o)1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.1.3.37-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14451]]
 
* [[RXN-15378]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=caldariellaquinol}}
+
{{#set: common-name=d-arabinono-1,4-lactone}}
{{#set: molecular-weight=633.085}}
+
{{#set: molecular-weight=148.115}}
{{#set: inchi-key=inchikey=uvcqokdzgiahdg-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=cuokhacjlgprhd-jjyyjpossa-n}}

Latest revision as of 19:34, 17 March 2021

Metabolite CPD-356

  • common-name:
    • d-arabinono-1,4-lactone
  • molecular-weight:
    • 148.115
  • inchi-key:
    • cuokhacjlgprhd-jjyyjpossa-n
  • smiles:
    • c(o)c1(oc(=o)c(o)c(o)1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality