Difference between revisions of "CPD-458"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Reduced-Rubredoxins == * common-name: ** a reduced rubredoxin == Reaction(s) known to consume the compound == * ALKANE-1-MONOOXYGENASE-...")
(Created page with "Category:metabolite == Metabolite CPD-458 == * common-name: ** galactinol * molecular-weight: ** 342.299 * inchi-key: ** vcwmrqdbpzkxkg-xidcdeprsa-n * smiles: ** c(c1(oc(c...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Reduced-Rubredoxins ==
+
== Metabolite CPD-458 ==
 
* common-name:
 
* common-name:
** a reduced rubredoxin
+
** galactinol
 +
* molecular-weight:
 +
** 342.299
 +
* inchi-key:
 +
** vcwmrqdbpzkxkg-xidcdeprsa-n
 +
* smiles:
 +
** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(c2o)o)o)o)o)))o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ALKANE-1-MONOOXYGENASE-RXN]]
+
* [[2.4.1.67-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.4.1.67-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a reduced rubredoxin}}
+
{{#set: common-name=galactinol}}
 +
{{#set: molecular-weight=342.299}}
 +
{{#set: inchi-key=inchikey=vcwmrqdbpzkxkg-xidcdeprsa-n}}

Latest revision as of 19:34, 17 March 2021

Metabolite CPD-458

  • common-name:
    • galactinol
  • molecular-weight:
    • 342.299
  • inchi-key:
    • vcwmrqdbpzkxkg-xidcdeprsa-n
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(c2o)o)o)o)o)))o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality