Difference between revisions of "3-METHYL-CROTONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-with-7-aminomethyl-7-deazaguanine == * common-name: ** a 7-aminomethyl-7-deazaguanosine34 in trna == Reaction(s) known to consume th...")
(Created page with "Category:metabolite == Metabolite 3-METHYL-CROTONYL-COA == * common-name: ** 3-methylcrotonyl-coa * molecular-weight: ** 845.604 * inchi-key: ** bxipalatiynhjn-zmhdxicwsa-...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-with-7-aminomethyl-7-deazaguanine ==
+
== Metabolite 3-METHYL-CROTONYL-COA ==
 
* common-name:
 
* common-name:
** a 7-aminomethyl-7-deazaguanosine34 in trna
+
** 3-methylcrotonyl-coa
 +
* molecular-weight:
 +
** 845.604
 +
* inchi-key:
 +
** bxipalatiynhjn-zmhdxicwsa-j
 +
* smiles:
 +
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 +
* [[RXN-14264]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-1321]]
+
* [[RXN-11921]]
 +
* [[RXN-14264]]
 +
* [[RXN0-2301]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 7-aminomethyl-7-deazaguanosine34 in trna}}
+
{{#set: common-name=3-methylcrotonyl-coa}}
 +
{{#set: molecular-weight=845.604}}
 +
{{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}}

Latest revision as of 19:34, 17 March 2021

Metabolite 3-METHYL-CROTONYL-COA

  • common-name:
    • 3-methylcrotonyl-coa
  • molecular-weight:
    • 845.604
  • inchi-key:
    • bxipalatiynhjn-zmhdxicwsa-j
  • smiles:
    • cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality