Difference between revisions of "DIHYDROLIPOYL-GCVH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-126 == * common-name: ** γ-carotene * molecular-weight: ** 536.882 * inchi-key: ** hrqkoyfghjyefs-bxolysjbsa-n * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite DIHYDROLIPOYL-GCVH == * common-name: ** a [glycine-cleavage complex h protein] n6-dihydrolipoyl-l-lysine == Reaction(s) known to consume...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-126 ==
+
== Metabolite DIHYDROLIPOYL-GCVH ==
 
* common-name:
 
* common-name:
** γ-carotene
+
** a [glycine-cleavage complex h protein] n6-dihydrolipoyl-l-lysine
* molecular-weight:
 
** 536.882
 
* inchi-key:
 
** hrqkoyfghjyefs-bxolysjbsa-n
 
* smiles:
 
** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1F-151]]
+
* [[GCVT-RXN]]
 +
* [[RXN-8629]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-150]]
+
* [[GCVT-RXN]]
 +
* [[RXN-8629]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-carotene}}
+
{{#set: common-name=a [glycine-cleavage complex h protein] n6-dihydrolipoyl-l-lysine}}
{{#set: molecular-weight=536.882}}
 
{{#set: inchi-key=inchikey=hrqkoyfghjyefs-bxolysjbsa-n}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite DIHYDROLIPOYL-GCVH

  • common-name:
    • a [glycine-cleavage complex h protein] n6-dihydrolipoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycine-cleavage complex h protein] n6-dihydrolipoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.