Difference between revisions of "UNDECAPRENYL-DIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-DEHYDRO-SHIKIMATE == * common-name: ** 3-dehydroshikimate * molecular-weight: ** 171.129 * inchi-key: ** slwwjzmphjjoph-phdidxhhsa-m *...")
(Created page with "Category:metabolite == Metabolite UNDECAPRENYL-DIPHOSPHATE == * common-name: ** di-trans,octa-cis-undecaprenyl diphosphate * molecular-weight: ** 924.251 * inchi-key: ** n...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-DEHYDRO-SHIKIMATE ==
+
== Metabolite UNDECAPRENYL-DIPHOSPHATE ==
 
* common-name:
 
* common-name:
** 3-dehydroshikimate
+
** di-trans,octa-cis-undecaprenyl diphosphate
 
* molecular-weight:
 
* molecular-weight:
** 171.129
+
** 924.251
 
* inchi-key:
 
* inchi-key:
** slwwjzmphjjoph-phdidxhhsa-m
+
** ntxgvhccxvhycl-ntdveaecsa-k
 
* smiles:
 
* smiles:
** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1)
+
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-])c)c)c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
 
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
* [[RXN-8999]]
* [[RXN-7968]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-dehydroshikimate}}
+
{{#set: common-name=di-trans,octa-cis-undecaprenyl diphosphate}}
{{#set: molecular-weight=171.129}}
+
{{#set: molecular-weight=924.251}}
{{#set: inchi-key=inchikey=slwwjzmphjjoph-phdidxhhsa-m}}
+
{{#set: inchi-key=inchikey=ntxgvhccxvhycl-ntdveaecsa-k}}

Latest revision as of 19:35, 17 March 2021

Metabolite UNDECAPRENYL-DIPHOSPHATE

  • common-name:
    • di-trans,octa-cis-undecaprenyl diphosphate
  • molecular-weight:
    • 924.251
  • inchi-key:
    • ntxgvhccxvhycl-ntdveaecsa-k
  • smiles:
    • cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-])c)c)c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality