Difference between revisions of "S-LACTOYL-GLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Lipid-hydroxy-fatty-acids == * common-name: ** a hydroxy-fatty-acyl-[lipid] == Reaction(s) known to consume the compound == == Reaction(s...") |
(Created page with "Category:metabolite == Metabolite S-LACTOYL-GLUTATHIONE == * common-name: ** (r)-s-lactoylglutathione * molecular-weight: ** 378.376 * inchi-key: ** vdydcvuwiliyqf-csmhcco...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite S-LACTOYL-GLUTATHIONE == |
* common-name: | * common-name: | ||
− | ** | + | ** (r)-s-lactoylglutathione |
+ | * molecular-weight: | ||
+ | ** 378.376 | ||
+ | * inchi-key: | ||
+ | ** vdydcvuwiliyqf-csmhccousa-m | ||
+ | * smiles: | ||
+ | ** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[GLYOXI-RXN]] | ||
+ | * [[GLYOXII-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GLYOXI-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(r)-s-lactoylglutathione}} |
+ | {{#set: molecular-weight=378.376}} | ||
+ | {{#set: inchi-key=inchikey=vdydcvuwiliyqf-csmhccousa-m}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite S-LACTOYL-GLUTATHIONE
- common-name:
- (r)-s-lactoylglutathione
- molecular-weight:
- 378.376
- inchi-key:
- vdydcvuwiliyqf-csmhccousa-m
- smiles:
- cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o