Difference between revisions of "GERANYLGERANYL-PP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-seryl-SEC-tRNAs == * common-name: ** an l-seryl-[trnasec] == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") |
(Created page with "Category:metabolite == Metabolite GERANYLGERANYL-PP == * common-name: ** geranylgeranyl diphosphate * molecular-weight: ** 447.424 * inchi-key: ** oinneunvozhbox-qircyjpos...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GERANYLGERANYL-PP == |
* common-name: | * common-name: | ||
− | ** | + | ** geranylgeranyl diphosphate |
+ | * molecular-weight: | ||
+ | ** 447.424 | ||
+ | * inchi-key: | ||
+ | ** oinneunvozhbox-qircyjposa-k | ||
+ | * smiles: | ||
+ | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.5.1.32-RXN]] | ||
+ | * [[RXN-10625]] | ||
+ | * [[RXN-11486]] | ||
+ | * [[RXN-13323]] | ||
+ | * [[RXN-3701]] | ||
+ | * [[RXN-7663]] | ||
+ | * [[RXN-7673]] | ||
+ | * [[RXN1F-144]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[FARNESYLTRANSTRANSFERASE-RXN]] |
+ | * [[RXN-7673]] | ||
+ | * [[RXN1F-144]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=geranylgeranyl diphosphate}} |
+ | {{#set: molecular-weight=447.424}} | ||
+ | {{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite GERANYLGERANYL-PP
- common-name:
- geranylgeranyl diphosphate
- molecular-weight:
- 447.424
- inchi-key:
- oinneunvozhbox-qircyjposa-k
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]