Difference between revisions of "L-ORNITHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Methylated-MttC-Proteins == * common-name: ** a [methyl-co(iii) trimethylamine-specific corrinoid protein] == Reaction(s) known to consum...")
(Created page with "Category:metabolite == Metabolite L-ORNITHINE == * common-name: ** l-ornithine * molecular-weight: ** 133.17 * inchi-key: ** ahlphdhhmvztml-bypyzucnsa-o * smiles: ** c(=o)...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Methylated-MttC-Proteins ==
+
== Metabolite L-ORNITHINE ==
 
* common-name:
 
* common-name:
** a [methyl-co(iii) trimethylamine-specific corrinoid protein]
+
** l-ornithine
 +
* molecular-weight:
 +
** 133.17
 +
* inchi-key:
 +
** ahlphdhhmvztml-bypyzucnsa-o
 +
* smiles:
 +
** c(=o)([o-])c([n+])ccc[n+]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8103]]
+
* [[ACETYLORNDEACET-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNDECARBOX-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8102]]
+
* [[ACETYLORNDEACET-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [methyl-co(iii) trimethylamine-specific corrinoid protein]}}
+
{{#set: common-name=l-ornithine}}
 +
{{#set: molecular-weight=133.17}}
 +
{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}

Latest revision as of 19:36, 17 March 2021