Difference between revisions of "HOMO-CIS-ACONITATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12646 == * common-name: ** (11z,14z)-icosadienoyl-coa * molecular-weight: ** 1053.99 * inchi-key: ** yckyouvxzzjciu-ygyqdceasa-j * sm...") |
(Created page with "Category:metabolite == Metabolite HOMO-CIS-ACONITATE == * common_name: ** cis-homoaconitate * smiles: ** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-] * inchi_key: ** inchikey=bjyp...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HOMO-CIS-ACONITATE == |
− | * | + | * common_name: |
− | ** | + | ** cis-homoaconitate |
− | |||
− | |||
− | |||
− | |||
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-] |
+ | * inchi_key: | ||
+ | ** inchikey=bjypzfuwwjsakc-arjawskdsa-k | ||
+ | * molecular_weight: | ||
+ | ** 185.113 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HOMOACONITATE-HYDRATASE-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN3O-1983]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: | + | {{#set: common_name=cis-homoaconitate}} |
− | {{#set: | + | {{#set: inchi_key=inchikey=bjypzfuwwjsakc-arjawskdsa-k}} |
− | {{#set: | + | {{#set: molecular_weight=185.113 }} |
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite HOMO-CIS-ACONITATE
- common_name:
- cis-homoaconitate
- smiles:
- c(=o)([o-])c=c(ccc([o-])=o)c(=o)[o-]
- inchi_key:
- inchikey=bjypzfuwwjsakc-arjawskdsa-k
- molecular_weight:
- 185.113