Difference between revisions of "ARG"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SULFOQUINOVOSYLDIACYLGLYCEROL == * common-name: ** an 6-sulfo-α-d-quinovosyl diacylglycerol == Reaction(s) known to consume the com...")
(Created page with "Category:metabolite == Metabolite ARG == * common-name: ** l-arginine * molecular-weight: ** 175.21 * inchi-key: ** odksfydxxfifqn-bypyzucnsa-o * smiles: ** c(nc(n)=[n+])c...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SULFOQUINOVOSYLDIACYLGLYCEROL ==
+
== Metabolite ARG ==
 
* common-name:
 
* common-name:
** an 6-sulfo-α-d-quinovosyl diacylglycerol
+
** l-arginine
 +
* molecular-weight:
 +
** 175.21
 +
* inchi-key:
 +
** odksfydxxfifqn-bypyzucnsa-o
 +
* smiles:
 +
** c(nc(n)=[n+])ccc([n+])c(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ARG-OXIDATION-RXN]]
 +
* [[ARGDECARBOX-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[ARGININE--TRNA-LIGASE-RXN]]
 +
* [[ARGSUCCINLYA-RXN]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1224]]
+
* [[ARGDECARBOX-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[ARGSUCCINLYA-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an 6-sulfo-α-d-quinovosyl diacylglycerol}}
+
{{#set: common-name=l-arginine}}
 +
{{#set: molecular-weight=175.21}}
 +
{{#set: inchi-key=inchikey=odksfydxxfifqn-bypyzucnsa-o}}

Latest revision as of 19:36, 17 March 2021

Metabolite ARG

  • common-name:
    • l-arginine
  • molecular-weight:
    • 175.21
  • inchi-key:
    • odksfydxxfifqn-bypyzucnsa-o
  • smiles:
    • c(nc(n)=[n+])ccc([n+])c(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality