Difference between revisions of "THREO-3-HYDROXY-L-ASPARTATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SUPER-OXIDE == * common-name: ** superoxide * molecular-weight: ** 31.999 * inchi-key: ** ouuqczgpvncoij-uhfffaoysa-m * smiles: ** [o-]o...") |
(Created page with "Category:metabolite == Metabolite THREO-3-HYDROXY-L-ASPARTATE == * common-name: ** (3s)-3-hydroxy-l-aspartate * molecular-weight: ** 148.095 * inchi-key: ** yylquhnpncgkjq...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite THREO-3-HYDROXY-L-ASPARTATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (3s)-3-hydroxy-l-aspartate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 148.095 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yylquhnpncgkjq-lwmbppnesa-m |
* smiles: | * smiles: | ||
| − | ** [o-]o | + | ** c(=o)([o-])c(o)c([n+])c(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[4.3.1.16-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[4.3.1.16-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(3s)-3-hydroxy-l-aspartate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=148.095}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yylquhnpncgkjq-lwmbppnesa-m}} |
Latest revision as of 19:37, 17 March 2021
Contents
Metabolite THREO-3-HYDROXY-L-ASPARTATE
- common-name:
- (3s)-3-hydroxy-l-aspartate
- molecular-weight:
- 148.095
- inchi-key:
- yylquhnpncgkjq-lwmbppnesa-m
- smiles:
- c(=o)([o-])c(o)c([n+])c(=o)[o-]
