Difference between revisions of "CPD0-2106"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TETRADECANOYL-COA == * common-name: ** myristoyl-coa * molecular-weight: ** 973.861 * inchi-key: ** duafkxofbzqtqe-qsgbvpjfsa-j * smiles:...") |
(Created page with "Category:metabolite == Metabolite CPD0-2106 == * common-name: ** 3-oxooctanoyl-coa * molecular-weight: ** 903.684 * inchi-key: ** wpivbcgrgvnddt-cecatxlmsa-j * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-2106 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxooctanoyl-coa |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 903.684 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wpivbcgrgvnddt-cecatxlmsa-j |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14277]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-oxooctanoyl-coa}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=903.684}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wpivbcgrgvnddt-cecatxlmsa-j}} |
Latest revision as of 19:37, 17 March 2021
Contents
Metabolite CPD0-2106
- common-name:
- 3-oxooctanoyl-coa
- molecular-weight:
- 903.684
- inchi-key:
- wpivbcgrgvnddt-cecatxlmsa-j
- smiles:
- cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
