Difference between revisions of "DIACYLGLYCEROL"

Latest revision as of 19:37, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15153 ==
+== Metabolite DIACYLGLYCEROL ==
 * common-name:
-** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
+** a 1,2-diacyl-sn-glycerol
-* molecular-weight:
-** 697.095
-* inchi-key:
-** flybtlrocqbhmr-kfsstaeesa-n
-* smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c(c)=1)
 == Reaction(s) known to consume the compound ==
+* [[2.4.1.46-RXN]]
+* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+* [[DIACYLGLYKIN-RXN]]
+* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
+* [[RXN-1224]]
+* [[RXN-12383]]
+* [[RXN-12959]]
+* [[RXN-16261]]
+* [[RXN-1641]]
+* [[RXN-16634]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-14177]]
+* [[3.1.4.11-RXN]]
+* [[PHOSPHATIDATE-PHOSPHATASE-RXN]]
+* [[RXN-1226]]
+* [[RXN-12383]]
+* [[RXN-13334]]
+* [[RXN-16261]]
+* [[RXN-16634]]
+* [[RXN-16635]]
+* [[RXN-9721]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}}
+{{#set: common-name=a 1,2-diacyl-sn-glycerol}}
-{{#set: molecular-weight=697.095}}
-{{#set: inchi-key=inchikey=flybtlrocqbhmr-kfsstaeesa-n}}