Difference between revisions of "G3P"

Latest revision as of 19:37, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-19160 ==
+== Metabolite G3P ==
 * common-name:
-** 3-oxo-(11z)-octadecenoyl-coa
+** 3-phospho-d-glycerate
 * molecular-weight:
-** 1041.936
+** 183.034
 * inchi-key:
-** ourowzutgfhrje-saiinbspsa-j
+** osjppgntcrnqqc-uwtatzphsa-k
 * smiles:
-** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** c(op(=o)([o-])[o-])c(o)c(=o)[o-]
 == Reaction(s) known to consume the compound ==
-* [[RXN-17787]]
+* [[3-PHOSPHOGLYCERATE-PHOSPHATASE-RXN]]
+* [[3PGAREARR-RXN]]
+* [[GLUCOSE-16-BISPHOSPHATE-SYNTHASE-RXN]]
+* [[PGLYCDEHYDROG-RXN]]
+* [[PHOSGLYPHOS-RXN]]
+* [[RXN-15511]]
+* [[RXN-15513]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17786]]
+* [[1.2.1.9-RXN]]
+* [[3PGAREARR-RXN]]
+* [[GLUCOSE-16-BISPHOSPHATE-SYNTHASE-RXN]]
+* [[PGLYCDEHYDROG-RXN]]
+* [[PHOSGLYPHOS-RXN]]
+* [[RXN-15511]]
+* [[RXN-15513]]
+* [[RXN-3443]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-oxo-(11z)-octadecenoyl-coa}}
+{{#set: common-name=3-phospho-d-glycerate}}
-{{#set: molecular-weight=1041.936}}
+{{#set: molecular-weight=183.034}}
-{{#set: inchi-key=inchikey=ourowzutgfhrje-saiinbspsa-j}}
+{{#set: inchi-key=inchikey=osjppgntcrnqqc-uwtatzphsa-k}}