Difference between revisions of "1-4-D-xylooligosaccharides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11608 == * common-name: ** β-sitosterol 3-o-β-d-glucoside * molecular-weight: ** 576.855 * inchi-key: ** npjictmalkltfw-kue...")
(Created page with "Category:metabolite == Metabolite CPD-7221 == * common-name: ** (3z)-dodec-3-enoyl-coa * molecular-weight: ** 943.792 * inchi-key: ** xemivmktvgrftd-qxmhvhedsa-j * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11608 ==
+
== Metabolite CPD-7221 ==
 
* common-name:
 
* common-name:
** β-sitosterol 3-o-β-d-glucoside
+
** (3z)-dodec-3-enoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 576.855
+
** 943.792
 
* inchi-key:
 
* inchi-key:
** npjictmalkltfw-kuenwnpssa-n
+
** xemivmktvgrftd-qxmhvhedsa-j
 
* smiles:
 
* smiles:
** ccc(c(c)c)ccc(c)[ch]4(cc[ch]5([ch]3(cc=c2(cc(oc1(oc(co)c(o)c(o)c(o)1))ccc(c)2[ch]3ccc(c)45))))
+
** ccccccccc=ccc(sccnc(ccnc(c(c(cop(op(occ3(c(op(=o)([o-])[o-])c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))(=o)[o-])(=o)[o-])(c)c)o)=o)=o)=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12128]]
+
* [[RXN-14394]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-sitosterol 3-o-β-d-glucoside}}
+
{{#set: common-name=(3z)-dodec-3-enoyl-coa}}
{{#set: molecular-weight=576.855}}
+
{{#set: molecular-weight=943.792}}
{{#set: inchi-key=inchikey=npjictmalkltfw-kuenwnpssa-n}}
+
{{#set: inchi-key=inchikey=xemivmktvgrftd-qxmhvhedsa-j}}

Revision as of 15:12, 15 March 2021

Metabolite CPD-7221

  • common-name:
    • (3z)-dodec-3-enoyl-coa
  • molecular-weight:
    • 943.792
  • inchi-key:
    • xemivmktvgrftd-qxmhvhedsa-j
  • smiles:
    • ccccccccc=ccc(sccnc(ccnc(c(c(cop(op(occ3(c(op(=o)([o-])[o-])c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))(=o)[o-])(=o)[o-])(c)c)o)=o)=o)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality