Difference between revisions of "1-4-D-xylooligosaccharides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BETA-TOCOPHEROL == * common-name: ** β-tocopherol * molecular-weight: ** 416.686 * inchi-key: ** wgvkwnupngfdfj-dqczwyhmsa-n * smile...")
(Created page with "Category:metabolite == Metabolite 1-4-D-xylooligosaccharides == * common-name: ** a (1->4)-β-d-xylan oligosaccharide == Reaction(s) known to consume the compound == =...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BETA-TOCOPHEROL ==
+
== Metabolite 1-4-D-xylooligosaccharides ==
 
* common-name:
 
* common-name:
** β-tocopherol
+
** a (1->4)-β-d-xylan oligosaccharide
* molecular-weight:
 
** 416.686
 
* inchi-key:
 
** wgvkwnupngfdfj-dqczwyhmsa-n
 
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2562]]
+
* [[3.2.1.8-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-tocopherol}}
+
{{#set: common-name=a (1->4)-β-d-xylan oligosaccharide}}
{{#set: molecular-weight=416.686}}
 
{{#set: inchi-key=inchikey=wgvkwnupngfdfj-dqczwyhmsa-n}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite 1-4-D-xylooligosaccharides

  • common-name:
    • a (1->4)-β-d-xylan oligosaccharide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (1->4)-β-d-xylan oligosaccharide" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.