Difference between revisions of "1-4-alpha-D-Glucan"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Hexanoyl-ACPs == * common-name: ** a hexanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9523 * RXN-9650 == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-590 == * common-name: ** (2r,3s,4s)-leucocyanidin * molecular-weight: ** 306.271 * inchi-key: ** sbzwtshafilote-souvjxgzsa-n * smiles...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-590 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2r,3s,4s)-leucocyanidin |
| + | * molecular-weight: | ||
| + | ** 306.271 | ||
| + | * inchi-key: | ||
| + | ** sbzwtshafilote-souvjxgzsa-n | ||
| + | * smiles: | ||
| + | ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-602]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-600]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2r,3s,4s)-leucocyanidin}} |
| + | {{#set: molecular-weight=306.271}} | ||
| + | {{#set: inchi-key=inchikey=sbzwtshafilote-souvjxgzsa-n}} | ||
Revision as of 17:55, 13 January 2021
Contents
Metabolite CPD-590
- common-name:
- (2r,3s,4s)-leucocyanidin
- molecular-weight:
- 306.271
- inchi-key:
- sbzwtshafilote-souvjxgzsa-n
- smiles:
- c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o)
