Difference between revisions of "1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSYL-HOMO-CYS == * common-name: ** s-adenosyl-l-homocysteine * molecular-weight: ** 384.409 * inchi-key: ** zjuktbdsgofhsh-wfmpwkqpsa...")
(Created page with "Category:metabolite == Metabolite CHONDROITIN-4-SULFATE == * common-name: ** a [chondroitin-sulfate] containing 4-o-sulfo-n-acetylgalactosamine == Reaction(s) known to con...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite ADENOSYL-HOMO-CYS ==
+
== Metabolite CHONDROITIN-4-SULFATE ==
 
* common-name:
 
* common-name:
−
** s-adenosyl-l-homocysteine
+
** a [chondroitin-sulfate] containing 4-o-sulfo-n-acetylgalactosamine
−
* molecular-weight:
 
−
** 384.409
 
−
* inchi-key:
 
−
** zjuktbdsgofhsh-wfmpwkqpsa-n
 
−
* smiles:
 
−
** c(scc3(c(o)c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))cc(c([o-])=o)[n+]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
+
* [[3.1.6.12-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[2.1.1.100-RXN]]
 
−
* [[2.1.1.125-RXN]]
 
−
* [[2.1.1.126-RXN]]
 
−
* [[2.1.1.135-RXN]]
 
−
* [[2.1.1.137-RXN]]
 
−
* [[2.1.1.138-RXN]]
 
−
* [[2.1.1.34-RXN]]
 
−
* [[2.1.1.57-RXN]]
 
−
* [[2.1.1.77-RXN]]
 
−
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
 
−
* [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
 
−
* [[GUANIDINOACETATE-N-METHYLTRANSFERASE-RXN]]
 
−
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
 
−
* [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
 
−
* [[RXN-11263]]
 
−
* [[RXN-11370]]
 
−
* [[RXN-11373]]
 
−
* [[RXN-11374]]
 
−
* [[RXN-11574]]
 
−
* [[RXN-11576]]
 
−
* [[RXN-11635]]
 
−
* [[RXN-13403]]
 
−
* [[RXN-13406]]
 
−
* [[RXN-14177]]
 
−
* [[RXN-14326]]
 
−
* [[RXN-2542]]
 
−
* [[RXN-2562]]
 
−
* [[RXN-4021]]
 
−
* [[RXN-5642]]
 
−
* [[RXN-6723]]
 
−
* [[RXN-7569]]
 
−
* [[RXN-7605]]
 
−
* [[RXN-8675]]
 
−
* [[RXN-8761]]
 
−
* [[RXN-8764]]
 
−
* [[RXN-8766]]
 
−
* [[RXN-8767]]
 
−
* [[RXN0-6515]]
 
−
* [[RXN1G-2527]]
 
−
* [[RXN1G-2544]]
 
−
* [[RXN1G-3232]]
 
−
* [[RXN1G-3256]]
 
−
* [[RXN1G-3613]]
 
−
* [[RXN1G-3641]]
 
−
* [[RXN1G-45]]
 
−
* [[RXN3O-178]]
 
−
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
 
−
* [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
 
−
* [[UROPORIIIMETHYLTRANSA-RXN]]
 
−
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=s-adenosyl-l-homocysteine}}
+
{{#set: common-name=a [chondroitin-sulfate] containing 4-o-sulfo-n-acetylgalactosamine}}
−
{{#set: molecular-weight=384.409}}
 
−
{{#set: inchi-key=inchikey=zjuktbdsgofhsh-wfmpwkqpsa-n}}
 

Revision as of 19:03, 17 March 2021

Metabolite CHONDROITIN-4-SULFATE

  • common-name:
    • a [chondroitin-sulfate] containing 4-o-sulfo-n-acetylgalactosamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [chondroitin-sulfate] containing 4-o-sulfo-n-acetylgalactosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol&oldid=39832"