Difference between revisions of "1-Alkyl-2-acyl-glycerol-3-phosphate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite C4 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine * molecular-weigh...")
(Created page with "Category:metabolite == Metabolite 1-Alkyl-2-acyl-glycerol-3-phosphate == * common-name: ** a 2-acyl-1-alkyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the com...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite C4 ==
+
== Metabolite 1-Alkyl-2-acyl-glycerol-3-phosphate ==
 
* common-name:
 
* common-name:
** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine
+
** a 2-acyl-1-alkyl-sn-glycerol 3-phosphate
* molecular-weight:
 
** 1670.034
 
* inchi-key:
 
** sulooaflxmqjsf-ogdyfqgpsa-k
 
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op(=o)([o-])oc1(c(nc(c)=o)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc[n+])c(nc(c)c(=o)nc(c)c([o-])=o)=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8975]]
+
* [[RXN-17730]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8975]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine}}
+
{{#set: common-name=a 2-acyl-1-alkyl-sn-glycerol 3-phosphate}}
{{#set: molecular-weight=1670.034}}
 
{{#set: inchi-key=inchikey=sulooaflxmqjsf-ogdyfqgpsa-k}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite 1-Alkyl-2-acyl-glycerol-3-phosphate

  • common-name:
    • a 2-acyl-1-alkyl-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality