Difference between revisions of "1-INDANOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE == * common-name: ** n-acetyl-β-glucosaminylamine * molecular-weight: ** 220.225 * inchi-key: ** mcg...")
(Created page with "Category:metabolite == Metabolite 1-INDANOL == * common-name: ** 1-indanol * molecular-weight: ** 134.177 * inchi-key: ** yiapldfpuujilh-uhfffaoysa-n * smiles: ** c2(c=cc1...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-ACETYL-BETA-GLUCOSAMINYLAMINE ==
+
== Metabolite 1-INDANOL ==
 
* common-name:
 
* common-name:
** n-acetyl-β-glucosaminylamine
+
** 1-indanol
 
* molecular-weight:
 
* molecular-weight:
** 220.225
+
** 134.177
 
* inchi-key:
 
* inchi-key:
** mcgxocxffnkasf-fmdgeedcsa-n
+
** yiapldfpuujilh-uhfffaoysa-n
 
* smiles:
 
* smiles:
** cc(=o)nc1(c(n)oc(co)c(o)c(o)1)
+
** c2(c=cc1(=c(ccc1o)c=2))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[INDANOL-DEHYDROGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.5.1.26-RXN]]
+
* [[INDANOL-DEHYDROGENASE-RXN]]
* [[3.5.1.52-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-β-glucosaminylamine}}
+
{{#set: common-name=1-indanol}}
{{#set: molecular-weight=220.225}}
+
{{#set: molecular-weight=134.177}}
{{#set: inchi-key=inchikey=mcgxocxffnkasf-fmdgeedcsa-n}}
+
{{#set: inchi-key=inchikey=yiapldfpuujilh-uhfffaoysa-n}}

Latest revision as of 19:36, 17 March 2021

Metabolite 1-INDANOL

  • common-name:
    • 1-indanol
  • molecular-weight:
    • 134.177
  • inchi-key:
    • yiapldfpuujilh-uhfffaoysa-n
  • smiles:
    • c2(c=cc1(=c(ccc1o)c=2))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality