Difference between revisions of "1-INDANONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Octanoylated-Gcv-H == * common-name: ** a [glycine-cleavage complex h protein] n6-octanoyl-l-lysine == Reaction(s) known to consume the c...") |
(Created page with "Category:metabolite == Metabolite CPD-12366 == * common-name: ** 8-oxo-gtp * molecular-weight: ** 535.151 * inchi-key: ** jchlkiqzuxylpw-ummcilcdsa-j * smiles: ** c(op(=o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12366 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 8-oxo-gtp |
| + | * molecular-weight: | ||
| + | ** 535.151 | ||
| + | * inchi-key: | ||
| + | ** jchlkiqzuxylpw-ummcilcdsa-j | ||
| + | * smiles: | ||
| + | ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(c(o)c(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11409]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=8-oxo-gtp}} |
| + | {{#set: molecular-weight=535.151}} | ||
| + | {{#set: inchi-key=inchikey=jchlkiqzuxylpw-ummcilcdsa-j}} | ||
Revision as of 17:50, 13 January 2021
Contents
Metabolite CPD-12366
- common-name:
- 8-oxo-gtp
- molecular-weight:
- 535.151
- inchi-key:
- jchlkiqzuxylpw-ummcilcdsa-j
- smiles:
- c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(c(o)c(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
