Difference between revisions of "1-L-MYO-INOSITOL-1-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SELENATE == * common-name: ** selenate * molecular-weight: ** 142.958 * inchi-key: ** qyhfivbsnowocq-uhfffaoysa-l * smiles: ** o=[se](=o)...") |
(Created page with "Category:metabolite == Metabolite CPD-18493 == * common-name: ** (3s,6z,9z,12z,15z,18z)-3-hydroxytetracosapentaenoyl-coa * molecular-weight: ** 1120.05 * inchi-key: ** nne...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-18493 == |
* common-name: | * common-name: | ||
− | ** | + | ** (3s,6z,9z,12z,15z,18z)-3-hydroxytetracosapentaenoyl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1120.05 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** nneppynerzejee-vugypbmhsa-j |
* smiles: | * smiles: | ||
− | ** o=[ | + | ** cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-17115]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-17114]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(3s,6z,9z,12z,15z,18z)-3-hydroxytetracosapentaenoyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1120.05}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nneppynerzejee-vugypbmhsa-j}} |
Revision as of 19:01, 17 March 2021
Contents
Metabolite CPD-18493
- common-name:
- (3s,6z,9z,12z,15z,18z)-3-hydroxytetracosapentaenoyl-coa
- molecular-weight:
- 1120.05
- inchi-key:
- nneppynerzejee-vugypbmhsa-j
- smiles:
- cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o