Difference between revisions of "1-L-MYO-INOSITOL-1-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SELENATE == * common-name: ** selenate * molecular-weight: ** 142.958 * inchi-key: ** qyhfivbsnowocq-uhfffaoysa-l * smiles: ** o=[se](=o)...")
(Created page with "Category:metabolite == Metabolite CPD-18493 == * common-name: ** (3s,6z,9z,12z,15z,18z)-3-hydroxytetracosapentaenoyl-coa * molecular-weight: ** 1120.05 * inchi-key: ** nne...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SELENATE ==
+
== Metabolite CPD-18493 ==
 
* common-name:
 
* common-name:
** selenate
+
** (3s,6z,9z,12z,15z,18z)-3-hydroxytetracosapentaenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 142.958
+
** 1120.05
 
* inchi-key:
 
* inchi-key:
** qyhfivbsnowocq-uhfffaoysa-l
+
** nneppynerzejee-vugypbmhsa-j
 
* smiles:
 
* smiles:
** o=[se](=o)([o-])[o-]
+
** cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12720]]
+
* [[RXN-17115]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17114]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=selenate}}
+
{{#set: common-name=(3s,6z,9z,12z,15z,18z)-3-hydroxytetracosapentaenoyl-coa}}
{{#set: molecular-weight=142.958}}
+
{{#set: molecular-weight=1120.05}}
{{#set: inchi-key=inchikey=qyhfivbsnowocq-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=nneppynerzejee-vugypbmhsa-j}}

Revision as of 19:01, 17 March 2021

Metabolite CPD-18493

  • common-name:
    • (3s,6z,9z,12z,15z,18z)-3-hydroxytetracosapentaenoyl-coa
  • molecular-weight:
    • 1120.05
  • inchi-key:
    • nneppynerzejee-vugypbmhsa-j
  • smiles:
    • cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality