Difference between revisions of "1-L-MYO-INOSITOL-1-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-Alkenylglycerophosphoethanolamines == * common-name: ** a 1-o-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine == Reaction(s) known to con...") |
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * molecular-weight: ** 258.121 * inchi-key: ** inapmgsxuvuwaf-p...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite 1- | + | == Metabolite 1-L-MYO-INOSITOL-1-P == |
* common-name: | * common-name: | ||
− | ** | + | ** 1d-myo-inositol 3-monophosphate |
+ | * molecular-weight: | ||
+ | ** 258.121 | ||
+ | * inchi-key: | ||
+ | ** inapmgsxuvuwaf-ptqmnwpwsa-l | ||
+ | * smiles: | ||
+ | ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]] |
+ | * [[RXN66-579]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1d-myo-inositol 3-monophosphate}} |
+ | {{#set: molecular-weight=258.121}} | ||
+ | {{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite 1-L-MYO-INOSITOL-1-P
- common-name:
- 1d-myo-inositol 3-monophosphate
- molecular-weight:
- 258.121
- inchi-key:
- inapmgsxuvuwaf-ptqmnwpwsa-l
- smiles:
- c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)