Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite URACIL == * common-name: ** uracil * molecular-weight: ** 112.088 * inchi-key: ** isakrjdgnuqoic-uhfffaoysa-n * smiles: ** c1(=cc(nc(=o)n...")
 
(Created page with "Category:metabolite == Metabolite CPD-14925 == * common-name: ** (3z)-dec-3-enoyl-coa * molecular-weight: ** 915.738 * inchi-key: ** cqgvnmqhzqjnii-uusbzyposa-j * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite URACIL ==
+
== Metabolite CPD-14925 ==
 
* common-name:
 
* common-name:
** uracil
+
** (3z)-dec-3-enoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 112.088
+
** 915.738
 
* inchi-key:
 
* inchi-key:
** isakrjdgnuqoic-uhfffaoysa-n
+
** cqgvnmqhzqjnii-uusbzyposa-j
 
* smiles:
 
* smiles:
** c1(=cc(nc(=o)n1)=o)
+
** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5398]]
 
* [[URACIL-PRIBOSYLTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5398]]
+
* [[RXN-17799]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=uracil}}
+
{{#set: common-name=(3z)-dec-3-enoyl-coa}}
{{#set: molecular-weight=112.088}}
+
{{#set: molecular-weight=915.738}}
{{#set: inchi-key=inchikey=isakrjdgnuqoic-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=cqgvnmqhzqjnii-uusbzyposa-j}}

Revision as of 17:57, 13 January 2021

Metabolite CPD-14925

  • common-name:
    • (3z)-dec-3-enoyl-coa
  • molecular-weight:
    • 915.738
  • inchi-key:
    • cqgvnmqhzqjnii-uusbzyposa-j
  • smiles:
    • ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality