Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14925 == * common-name: ** (3z)-dec-3-enoyl-coa * molecular-weight: ** 915.738 * inchi-key: ** cqgvnmqhzqjnii-uusbzyposa-j * smiles:...")
(Created page with "Category:metabolite == Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA == * common-name: ** a 1-phosphatidyl-1d-myo-inositol 5-phosphate == Reaction(s) known to consum...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-14925 ==
+
== Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA ==
 
* common-name:
 
* common-name:
−
** (3z)-dec-3-enoyl-coa
+
** a 1-phosphatidyl-1d-myo-inositol 5-phosphate
−
* molecular-weight:
 
−
** 915.738
 
−
* inchi-key:
 
−
** cqgvnmqhzqjnii-uusbzyposa-j
 
−
* smiles:
 
−
** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.1.149-RXN]]
 +
* [[RXN-10962]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-17799]]
+
* [[RXN-10958]]
 +
* [[RXN-9779]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(3z)-dec-3-enoyl-coa}}
+
{{#set: common-name=a 1-phosphatidyl-1d-myo-inositol 5-phosphate}}
−
{{#set: molecular-weight=915.738}}
 
−
{{#set: inchi-key=inchikey=cqgvnmqhzqjnii-uusbzyposa-j}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA

  • common-name:
    • a 1-phosphatidyl-1d-myo-inositol 5-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA&oldid=50103"