Difference between revisions of "2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-"

Revision as of 17:55, 13 January 2021

common-name:
- chlorophyllide a
molecular-weight:
- 612.967
smiles:
- c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n(.[mg]36(.n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite GERANYLGERANYL-PP ==
+== Metabolite CHLOROPHYLLIDE-A ==
 * common-name:
-** geranylgeranyl diphosphate
+** chlorophyllide a
 * molecular-weight:
-** 447.424
+** 612.967
-* inchi-key:
-** oinneunvozhbox-qircyjposa-k
 * smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n(.[mg]36(.n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 == Reaction(s) known to consume the compound ==
-* [[2.5.1.32-RXN]]
+* [[RXN-13398]]
-* [[RXN-10625]]
-* [[RXN-11486]]
-* [[RXN-13323]]
-* [[RXN-3701]]
 * [[RXN-7663]]
-* [[RXN-7673]]
+* [[RXN-7676]]
-* [[RXN1F-144]]
+* [[RXN1F-66]]
 == Reaction(s) known to produce the compound ==
-* [[FARNESYLTRANSTRANSFERASE-RXN]]
+* [[RXN1F-10]]
-* [[RXN-7673]]
+* [[RXN1F-66]]
-* [[RXN1F-144]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=geranylgeranyl diphosphate}}
+{{#set: common-name=chlorophyllide a}}
-{{#set: molecular-weight=447.424}}
+{{#set: molecular-weight=612.967}}
-{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}