Difference between revisions of "2-ALPHA-HYDROXYETHYL-THPP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite S-CD-S-SP-Complex == * common-name: ** an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex == Reac...") |
(Created page with "Category:metabolite == Metabolite IMIDAZOLE-PYRUVATE == * common-name: ** imidazole-pyruvate * molecular-weight: ** 153.117 * inchi-key: ** jejnwereqwmohb-uhfffaoysa-m * s...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite IMIDAZOLE-PYRUVATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** imidazole-pyruvate |
| + | * molecular-weight: | ||
| + | ** 153.117 | ||
| + | * inchi-key: | ||
| + | ** jejnwereqwmohb-uhfffaoysa-m | ||
| + | * smiles: | ||
| + | ** c1(nc=nc(cc(=o)c(=o)[o-])=1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7571]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7571]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=imidazole-pyruvate}} |
| + | {{#set: molecular-weight=153.117}} | ||
| + | {{#set: inchi-key=inchikey=jejnwereqwmohb-uhfffaoysa-m}} | ||
Revision as of 19:03, 17 March 2021
Contents
Metabolite IMIDAZOLE-PYRUVATE
- common-name:
- imidazole-pyruvate
- molecular-weight:
- 153.117
- inchi-key:
- jejnwereqwmohb-uhfffaoysa-m
- smiles:
- c1(nc=nc(cc(=o)c(=o)[o-])=1)
