Difference between revisions of "2-ALPHA-HYDROXYETHYL-THPP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3R-9Z-3-hydroxy-octadec-9-enoyl-ACPs == * common-name: ** a (3r,9z)-3-hydroxy-octadec-9-enoyl-[acp] == Reaction(s) known to consume the c...")
(Created page with "Category:metabolite == Metabolite 2-ALPHA-HYDROXYETHYL-THPP == * common-name: ** 2-(α-hydroxyethyl)thiamine diphosphate * molecular-weight: ** 466.341 * inchi-key: *...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3R-9Z-3-hydroxy-octadec-9-enoyl-ACPs ==
+
== Metabolite 2-ALPHA-HYDROXYETHYL-THPP ==
 
* common-name:
 
* common-name:
** a (3r,9z)-3-hydroxy-octadec-9-enoyl-[acp]
+
** 2-(α-hydroxyethyl)thiamine diphosphate
 +
* molecular-weight:
 +
** 466.341
 +
* inchi-key:
 +
** rruvjgasjonmdy-uhfffaoysa-l
 +
* smiles:
 +
** cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c)=nc(n)=1))2)ccop(=o)([o-])op(=o)([o-])[o-])
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16627]]
+
* [[RXN-12508]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16626]]
+
* [[RXN-12583]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (3r,9z)-3-hydroxy-octadec-9-enoyl-[acp]}}
+
{{#set: common-name=2-(α-hydroxyethyl)thiamine diphosphate}}
 +
{{#set: molecular-weight=466.341}}
 +
{{#set: inchi-key=inchikey=rruvjgasjonmdy-uhfffaoysa-l}}

Latest revision as of 19:36, 17 March 2021

Metabolite 2-ALPHA-HYDROXYETHYL-THPP

  • common-name:
    • 2-(α-hydroxyethyl)thiamine diphosphate
  • molecular-weight:
    • 466.341
  • inchi-key:
    • rruvjgasjonmdy-uhfffaoysa-l
  • smiles:
    • cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c)=nc(n)=1))2)ccop(=o)([o-])op(=o)([o-])[o-])

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality