Difference between revisions of "2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P == * common-name: ** 5-enolpyruvoyl-shikimate 3-phosphate * molecular-weight: ** 320.149 * inchi-key: ** qutyk...")
(Created page with "Category:metabolite == Metabolite 2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI == * common-name: ** 2-amino-3-carboxymuconate-6-semialdehyde * molecular-weight: ** 183.12 * inch...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P ==
+
== Metabolite 2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI ==
 
* common-name:
 
* common-name:
−
** 5-enolpyruvoyl-shikimate 3-phosphate
+
** 2-amino-3-carboxymuconate-6-semialdehyde
 
* molecular-weight:
 
* molecular-weight:
−
** 320.149
+
** 183.12
 
* inchi-key:
 
* inchi-key:
−
** qutykixiudqolk-prjmdxoysa-j
+
** kacpvqqhdvbvfc-pmrvsphwsa-l
 
* smiles:
 
* smiles:
−
** c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=o)([o-])[o-])c(o)1)
+
** c(=o)([o-])c(=c(c([o-])=o)n)c=c[ch]=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[2.5.1.19-RXN]]
+
* [[RXN-5721]]
−
* [[CHORISMATE-SYNTHASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[2.5.1.19-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=5-enolpyruvoyl-shikimate 3-phosphate}}
+
{{#set: common-name=2-amino-3-carboxymuconate-6-semialdehyde}}
−
{{#set: molecular-weight=320.149}}
+
{{#set: molecular-weight=183.12}}
−
{{#set: inchi-key=inchikey=qutykixiudqolk-prjmdxoysa-j}}
+
{{#set: inchi-key=inchikey=kacpvqqhdvbvfc-pmrvsphwsa-l}}

Latest revision as of 19:33, 17 March 2021

Metabolite 2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI

  • common-name:
    • 2-amino-3-carboxymuconate-6-semialdehyde
  • molecular-weight:
    • 183.12
  • inchi-key:
    • kacpvqqhdvbvfc-pmrvsphwsa-l
  • smiles:
    • c(=o)([o-])c(=c(c([o-])=o)n)c=c[ch]=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI&oldid=48742"