Difference between revisions of "2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15172 == * common-name: ** 6,7-dehydrobaicalein * molecular-weight: ** 268.225 * inchi-key: ** lsqwciyrgvwpfx-uhfffaoysa-n * smiles:...")
 
(Created page with "Category:metabolite == Metabolite CPD-8355 == * common-name: ** 1-(oleoyl)-sn-glycero-3-phosphoethanolamine * molecular-weight: ** 479.593 * inchi-key: ** pyvrvrfvlrnjly-m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15172 ==
+
== Metabolite CPD-8355 ==
 
* common-name:
 
* common-name:
** 6,7-dehydrobaicalein
+
** 1-(oleoyl)-sn-glycero-3-phosphoethanolamine
 
* molecular-weight:
 
* molecular-weight:
** 268.225
+
** 479.593
 
* inchi-key:
 
* inchi-key:
** lsqwciyrgvwpfx-uhfffaoysa-n
+
** pyvrvrfvlrnjly-mzmpxxgtsa-n
 
* smiles:
 
* smiles:
** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3)))
+
** ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15035]]
 +
* [[RXN-15036]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14240]]
+
* [[RXN-15036]]
 +
* [[RXN-15067]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6,7-dehydrobaicalein}}
+
{{#set: common-name=1-(oleoyl)-sn-glycero-3-phosphoethanolamine}}
{{#set: molecular-weight=268.225}}
+
{{#set: molecular-weight=479.593}}
{{#set: inchi-key=inchikey=lsqwciyrgvwpfx-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=pyvrvrfvlrnjly-mzmpxxgtsa-n}}

Revision as of 17:52, 13 January 2021

Metabolite CPD-8355

  • common-name:
    • 1-(oleoyl)-sn-glycero-3-phosphoethanolamine
  • molecular-weight:
    • 479.593
  • inchi-key:
    • pyvrvrfvlrnjly-mzmpxxgtsa-n
  • smiles:
    • ccccccccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality